C26H35N3O5S — CID 118384222
(Z)-3-cyano-N-[2-[2-(2-methoxyethoxy)ethoxy]ethyl]-2-(6-piperidin-1-ylnaphthalen-2-yl)prop-1-ene-1-sulfonamide (PubChem CID 118384222) has the molecular formula C26H35N3O5S and a molecular weight of 501.65 g/mol. Its IUPAC name is (Z)-3-cyano-N-[2-[2-(2-methoxyethoxy)ethoxy]ethyl]-2-(6-piperidin-1-ylnaphthalen-2-yl)prop-1-ene-1-sulfonamide.
| Compound Name | (Z)-3-cyano-N-[2-[2-(2-methoxyethoxy)ethoxy]ethyl]-2-(6-piperidin-1-ylnaphthalen-2-yl)prop-1-ene-1-sulfonamide |
|---|---|
| PubChem CID | 118384222 |
| Molecular Formula | C26H35N3O5S |
| Molecular Weight | 501.65 g/mol |
| Exact Mass | 501.23 |
| IUPAC Name | (Z)-3-cyano-N-[2-[2-(2-methoxyethoxy)ethoxy]ethyl]-2-(6-piperidin-1-ylnaphthalen-2-yl)prop-1-ene-1-sulfonamide |
| SMILES | COCCOCCOCCNS(=O)(=O)/C=C(/CC#N)c1ccc2cc(N3CCCCC3)ccc2c1 |
| InChI | InChI=1S/C26H35N3O5S/c1-32-15-16-34-18-17-33-14-11-28-35(30,31)21-25(9-10-27)23-5-6-24-20-26(8-7-22(24)19-23)29-12-3-2-4-13-29/h5-8,19-21,28H,2-4,9,11-18H2,1H3/b25-21- |
| InChIKey | WPUCSRMGRVPAIU-DAFNUICNSA-N |
| XLogP | 3.68 |
| TPSA | 100.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.65 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|