C17H28N2O5S — CID 110613184
2-(2-methoxyethoxy)-N-(2-methoxy-5-piperidin-1-ylphenyl)ethanesulfonamide (PubChem CID 110613184) has the molecular formula C17H28N2O5S and a molecular weight of 372.49 g/mol. Its IUPAC name is 2-(2-methoxyethoxy)-N-(2-methoxy-5-piperidin-1-ylphenyl)ethanesulfonamide.
| Compound Name | 2-(2-methoxyethoxy)-N-(2-methoxy-5-piperidin-1-ylphenyl)ethanesulfonamide |
|---|---|
| PubChem CID | 110613184 |
| Molecular Formula | C17H28N2O5S |
| Molecular Weight | 372.49 g/mol |
| Exact Mass | 372.17 |
| IUPAC Name | 2-(2-methoxyethoxy)-N-(2-methoxy-5-piperidin-1-ylphenyl)ethanesulfonamide |
| SMILES | COCCOCCS(=O)(=O)Nc1cc(N2CCCCC2)ccc1OC |
| InChI | InChI=1S/C17H28N2O5S/c1-22-10-11-24-12-13-25(20,21)18-16-14-15(6-7-17(16)23-2)19-8-4-3-5-9-19/h6-7,14,18H,3-5,8-13H2,1-2H3 |
| InChIKey | PEXSFGPINGQWPJ-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 77.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.49 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|