C20H26N2O3S — CID 110359721
N-(2-methoxy-5-piperidin-1-ylphenyl)-1-(2-methylphenyl)methanesulfonamide (PubChem CID 110359721) has the molecular formula C20H26N2O3S and a molecular weight of 374.51 g/mol. Its IUPAC name is N-(2-methoxy-5-piperidin-1-ylphenyl)-1-(2-methylphenyl)methanesulfonamide.
| Compound Name | N-(2-methoxy-5-piperidin-1-ylphenyl)-1-(2-methylphenyl)methanesulfonamide |
|---|---|
| PubChem CID | 110359721 |
| Molecular Formula | C20H26N2O3S |
| Molecular Weight | 374.51 g/mol |
| Exact Mass | 374.17 |
| IUPAC Name | N-(2-methoxy-5-piperidin-1-ylphenyl)-1-(2-methylphenyl)methanesulfonamide |
| SMILES | COc1ccc(N2CCCCC2)cc1NS(=O)(=O)Cc1ccccc1C |
| InChI | InChI=1S/C20H26N2O3S/c1-16-8-4-5-9-17(16)15-26(23,24)21-19-14-18(10-11-20(19)25-2)22-12-6-3-7-13-22/h4-5,8-11,14,21H,3,6-7,12-13,15H2,1-2H3 |
| InChIKey | SWDMZXDBCIVHSE-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.51 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|