C20H27N3O8S — CID 153371577
(E)-1-cyano-2-(4-morpholin-4-ylphenyl)-N-[[(2R,3S,4S,5R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]methyl]ethenesulfonamide (PubChem CID 153371577) has the molecular formula C20H27N3O8S and a molecular weight of 469.52 g/mol. Its IUPAC name is (E)-1-cyano-2-(4-morpholin-4-ylphenyl)-N-[[(2R,3S,4S,5R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]methyl]ethenesulfonamide.
| Compound Name | (E)-1-cyano-2-(4-morpholin-4-ylphenyl)-N-[[(2R,3S,4S,5R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]methyl]ethenesulfonamide |
|---|---|
| PubChem CID | 153371577 |
| Molecular Formula | C20H27N3O8S |
| Molecular Weight | 469.52 g/mol |
| Exact Mass | 469.15 |
| IUPAC Name | (E)-1-cyano-2-(4-morpholin-4-ylphenyl)-N-[[(2R,3S,4S,5R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]methyl]ethenesulfonamide |
| SMILES | N#C/C(=C\c1ccc(N2CCOCC2)cc1)S(=O)(=O)NC[C@H]1OC(CO)[C@H](O)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C20H27N3O8S/c21-10-15(9-13-1-3-14(4-2-13)23-5-7-30-8-6-23)32(28,29)22-11-16-18(25)20(27)19(26)17(12-24)31-16/h1-4,9,16-20,22,24-27H,5-8,11-12H2/b15-9+/t16-,17?,18-,19+,20+/m1/s1 |
| InChIKey | OJCVUFBCHNGXRY-JITHOZEXSA-N |
| XLogP | -1.85 |
| TPSA | 172.58 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.52 |
| LogP ≤ 5 | -1.85 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|