C17H23N3O4S — CID 123614616
1-cyano-N-(2,3-dihydroxypropyl)-2-(4-piperidin-1-ylphenyl)ethenesulfonamide (PubChem CID 123614616) has the molecular formula C17H23N3O4S and a molecular weight of 365.46 g/mol. Its IUPAC name is 1-cyano-N-(2,3-dihydroxypropyl)-2-(4-piperidin-1-ylphenyl)ethenesulfonamide.
| Compound Name | 1-cyano-N-(2,3-dihydroxypropyl)-2-(4-piperidin-1-ylphenyl)ethenesulfonamide |
|---|---|
| PubChem CID | 123614616 |
| Molecular Formula | C17H23N3O4S |
| Molecular Weight | 365.46 g/mol |
| Exact Mass | 365.14 |
| IUPAC Name | 1-cyano-N-(2,3-dihydroxypropyl)-2-(4-piperidin-1-ylphenyl)ethenesulfonamide |
| SMILES | N#CC(=Cc1ccc(N2CCCCC2)cc1)S(=O)(=O)NCC(O)CO |
| InChI | InChI=1S/C17H23N3O4S/c18-11-17(25(23,24)19-12-16(22)13-21)10-14-4-6-15(7-5-14)20-8-2-1-3-9-20/h4-7,10,16,19,21-22H,1-3,8-9,12-13H2 |
| InChIKey | HJTAYKSBNJETHJ-UHFFFAOYSA-N |
| XLogP | 0.81 |
| TPSA | 113.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.46 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|