C16H21N3O5S — CID 123257873
1-cyano-N-(2,3-dihydroxypropyl)-2-(4-morpholin-4-ylphenyl)ethenesulfonamide (PubChem CID 123257873) has the molecular formula C16H21N3O5S and a molecular weight of 367.43 g/mol. Its IUPAC name is 1-cyano-N-(2,3-dihydroxypropyl)-2-(4-morpholin-4-ylphenyl)ethenesulfonamide.
| Compound Name | 1-cyano-N-(2,3-dihydroxypropyl)-2-(4-morpholin-4-ylphenyl)ethenesulfonamide |
|---|---|
| PubChem CID | 123257873 |
| Molecular Formula | C16H21N3O5S |
| Molecular Weight | 367.43 g/mol |
| Exact Mass | 367.12 |
| IUPAC Name | 1-cyano-N-(2,3-dihydroxypropyl)-2-(4-morpholin-4-ylphenyl)ethenesulfonamide |
| SMILES | N#CC(=Cc1ccc(N2CCOCC2)cc1)S(=O)(=O)NCC(O)CO |
| InChI | InChI=1S/C16H21N3O5S/c17-10-16(25(22,23)18-11-15(21)12-20)9-13-1-3-14(4-2-13)19-5-7-24-8-6-19/h1-4,9,15,18,20-21H,5-8,11-12H2 |
| InChIKey | NOZUURLUMXEARH-UHFFFAOYSA-N |
| XLogP | -0.34 |
| TPSA | 122.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.43 |
| LogP ≤ 5 | -0.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|