C23H30N4O4S — CID 122682489
(E)-1-cyano-N-(2-hydroxybutyl)-2-[6-(2-morpholin-4-ylethylamino)naphthalen-2-yl]ethenesulfonamide (PubChem CID 122682489) has the molecular formula C23H30N4O4S and a molecular weight of 458.58 g/mol. Its IUPAC name is (E)-1-cyano-N-(2-hydroxybutyl)-2-[6-(2-morpholin-4-ylethylamino)naphthalen-2-yl]ethenesulfonamide.
| Compound Name | (E)-1-cyano-N-(2-hydroxybutyl)-2-[6-(2-morpholin-4-ylethylamino)naphthalen-2-yl]ethenesulfonamide |
|---|---|
| PubChem CID | 122682489 |
| Molecular Formula | C23H30N4O4S |
| Molecular Weight | 458.58 g/mol |
| Exact Mass | 458.20 |
| IUPAC Name | (E)-1-cyano-N-(2-hydroxybutyl)-2-[6-(2-morpholin-4-ylethylamino)naphthalen-2-yl]ethenesulfonamide |
| SMILES | CCC(O)CNS(=O)(=O)/C(C#N)=C/c1ccc2cc(NCCN3CCOCC3)ccc2c1 |
| InChI | InChI=1S/C23H30N4O4S/c1-2-22(28)17-26-32(29,30)23(16-24)14-18-3-4-20-15-21(6-5-19(20)13-18)25-7-8-27-9-11-31-12-10-27/h3-6,13-15,22,25-26,28H,2,7-12,17H2,1H3/b23-14+ |
| InChIKey | MYTWCQCDXNDJRX-OEAKJJBVSA-N |
| XLogP | 2.14 |
| TPSA | 114.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.58 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|