C23H31N3O3S — CID 122682521
(E)-1-cyano-2-[6-(dipropylamino)naphthalen-2-yl]-N-(2-hydroxybutyl)ethenesulfonamide (PubChem CID 122682521) has the molecular formula C23H31N3O3S and a molecular weight of 429.59 g/mol. Its IUPAC name is (E)-1-cyano-2-[6-(dipropylamino)naphthalen-2-yl]-N-(2-hydroxybutyl)ethenesulfonamide.
| Compound Name | (E)-1-cyano-2-[6-(dipropylamino)naphthalen-2-yl]-N-(2-hydroxybutyl)ethenesulfonamide |
|---|---|
| PubChem CID | 122682521 |
| Molecular Formula | C23H31N3O3S |
| Molecular Weight | 429.59 g/mol |
| Exact Mass | 429.21 |
| IUPAC Name | (E)-1-cyano-2-[6-(dipropylamino)naphthalen-2-yl]-N-(2-hydroxybutyl)ethenesulfonamide |
| SMILES | CCCN(CCC)c1ccc2cc(/C=C(\C#N)S(=O)(=O)NCC(O)CC)ccc2c1 |
| InChI | InChI=1S/C23H31N3O3S/c1-4-11-26(12-5-2)21-10-9-19-13-18(7-8-20(19)15-21)14-23(16-24)30(28,29)25-17-22(27)6-3/h7-10,13-15,22,25,27H,4-6,11-12,17H2,1-3H3/b23-14+ |
| InChIKey | AEOWJRQHSVLJGN-OEAKJJBVSA-N |
| XLogP | 4.02 |
| TPSA | 93.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.59 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|