C18H25N3O3S — CID 122682483
(E)-1-cyano-N-(2-hydroxybutyl)-2-(4-piperidin-1-ylphenyl)ethenesulfonamide (PubChem CID 122682483) has the molecular formula C18H25N3O3S and a molecular weight of 363.48 g/mol. Its IUPAC name is (E)-1-cyano-N-(2-hydroxybutyl)-2-(4-piperidin-1-ylphenyl)ethenesulfonamide.
| Compound Name | (E)-1-cyano-N-(2-hydroxybutyl)-2-(4-piperidin-1-ylphenyl)ethenesulfonamide |
|---|---|
| PubChem CID | 122682483 |
| Molecular Formula | C18H25N3O3S |
| Molecular Weight | 363.48 g/mol |
| Exact Mass | 363.16 |
| IUPAC Name | (E)-1-cyano-N-(2-hydroxybutyl)-2-(4-piperidin-1-ylphenyl)ethenesulfonamide |
| SMILES | CCC(O)CNS(=O)(=O)/C(C#N)=C/c1ccc(N2CCCCC2)cc1 |
| InChI | InChI=1S/C18H25N3O3S/c1-2-17(22)14-20-25(23,24)18(13-19)12-15-6-8-16(9-7-15)21-10-4-3-5-11-21/h6-9,12,17,20,22H,2-5,10-11,14H2,1H3/b18-12+ |
| InChIKey | CALVFXCWIOOGEJ-LDADJPATSA-N |
| XLogP | 2.23 |
| TPSA | 93.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.48 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|