C22H33N3O4S — CID 123427840
1-cyano-N-[2-methyl-4-[(2-methylpropan-2-yl)oxy]butan-2-yl]-2-(4-morpholin-4-ylphenyl)ethenesulfonamide (PubChem CID 123427840) has the molecular formula C22H33N3O4S and a molecular weight of 435.59 g/mol. Its IUPAC name is 1-cyano-N-[2-methyl-4-[(2-methylpropan-2-yl)oxy]butan-2-yl]-2-(4-morpholin-4-ylphenyl)ethenesulfonamide.
| Compound Name | 1-cyano-N-[2-methyl-4-[(2-methylpropan-2-yl)oxy]butan-2-yl]-2-(4-morpholin-4-ylphenyl)ethenesulfonamide |
|---|---|
| PubChem CID | 123427840 |
| Molecular Formula | C22H33N3O4S |
| Molecular Weight | 435.59 g/mol |
| Exact Mass | 435.22 |
| IUPAC Name | 1-cyano-N-[2-methyl-4-[(2-methylpropan-2-yl)oxy]butan-2-yl]-2-(4-morpholin-4-ylphenyl)ethenesulfonamide |
| SMILES | CC(C)(CCOC(C)(C)C)NS(=O)(=O)C(C#N)=Cc1ccc(N2CCOCC2)cc1 |
| InChI | InChI=1S/C22H33N3O4S/c1-21(2,3)29-13-10-22(4,5)24-30(26,27)20(17-23)16-18-6-8-19(9-7-18)25-11-14-28-15-12-25/h6-9,16,24H,10-15H2,1-5H3 |
| InChIKey | LCEBNIWNQIRRPC-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 91.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.59 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|