C24H37N3O2 — CID 144927693
(E)-2-cyano-3-(4-piperidin-1-ylphenyl)prop-2-enamide;3-methyl-1-[(2-methylpropan-2-yl)oxy]butane (PubChem CID 144927693) has the molecular formula C24H37N3O2 and a molecular weight of 399.58 g/mol. Its IUPAC name is (E)-2-cyano-3-(4-piperidin-1-ylphenyl)prop-2-enamide;3-methyl-1-[(2-methylpropan-2-yl)oxy]butane.
| Compound Name | (E)-2-cyano-3-(4-piperidin-1-ylphenyl)prop-2-enamide;3-methyl-1-[(2-methylpropan-2-yl)oxy]butane |
|---|---|
| PubChem CID | 144927693 |
| Molecular Formula | C24H37N3O2 |
| Molecular Weight | 399.58 g/mol |
| Exact Mass | 399.29 |
| IUPAC Name | (E)-2-cyano-3-(4-piperidin-1-ylphenyl)prop-2-enamide;3-methyl-1-[(2-methylpropan-2-yl)oxy]butane |
| SMILES | CC(C)CCOC(C)(C)C.N#C/C(=C\c1ccc(N2CCCCC2)cc1)C(N)=O |
| InChI | InChI=1S/C15H17N3O.C9H20O/c16-11-13(15(17)19)10-12-4-6-14(7-5-12)18-8-2-1-3-9-18;1-8(2)6-7-10-9(3,4)5/h4-7,10H,1-3,8-9H2,(H2,17,19);8H,6-7H2,1-5H3/b13-10+; |
| InChIKey | QGEWGDNXHBHDJC-RSGUCCNWSA-N |
| XLogP | 4.92 |
| TPSA | 79.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.58 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|