C24H29N3O7S — CID 122682642
(E)-1-cyano-2-(6-morpholin-4-ylnaphthalen-2-yl)-N-[[(2R,3S,4R,5R)-3,4,6-trihydroxy-5-methyloxan-2-yl]methyl]ethenesulfonamide (PubChem CID 122682642) has the molecular formula C24H29N3O7S and a molecular weight of 503.58 g/mol. Its IUPAC name is (E)-1-cyano-2-(6-morpholin-4-ylnaphthalen-2-yl)-N-[[(2R,3S,4R,5R)-3,4,6-trihydroxy-5-methyloxan-2-yl]methyl]ethenesulfonamide.
| Compound Name | (E)-1-cyano-2-(6-morpholin-4-ylnaphthalen-2-yl)-N-[[(2R,3S,4R,5R)-3,4,6-trihydroxy-5-methyloxan-2-yl]methyl]ethenesulfonamide |
|---|---|
| PubChem CID | 122682642 |
| Molecular Formula | C24H29N3O7S |
| Molecular Weight | 503.58 g/mol |
| Exact Mass | 503.17 |
| IUPAC Name | (E)-1-cyano-2-(6-morpholin-4-ylnaphthalen-2-yl)-N-[[(2R,3S,4R,5R)-3,4,6-trihydroxy-5-methyloxan-2-yl]methyl]ethenesulfonamide |
| SMILES | C[C@H]1C(O)O[C@H](CNS(=O)(=O)/C(C#N)=C/c2ccc3cc(N4CCOCC4)ccc3c2)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C24H29N3O7S/c1-15-22(28)23(29)21(34-24(15)30)14-26-35(31,32)20(13-25)11-16-2-3-18-12-19(5-4-17(18)10-16)27-6-8-33-9-7-27/h2-5,10-12,15,21-24,26,28-30H,6-9,14H2,1H3/b20-11+/t15-,21-,22-,23-,24?/m1/s1 |
| InChIKey | UIMFAOYYXVTORD-BFYZZCNWSA-N |
| XLogP | 0.54 |
| TPSA | 152.35 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.58 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|