C16H21N3O4S — CID 118401029
(E)-1-cyano-N-(2,3-dihydroxypropyl)-2-(4-morpholin-4-ylphenyl)ethenesulfinamide (PubChem CID 118401029) has the molecular formula C16H21N3O4S and a molecular weight of 351.43 g/mol. Its IUPAC name is (E)-1-cyano-N-(2,3-dihydroxypropyl)-2-(4-morpholin-4-ylphenyl)ethenesulfinamide.
| Compound Name | (E)-1-cyano-N-(2,3-dihydroxypropyl)-2-(4-morpholin-4-ylphenyl)ethenesulfinamide |
|---|---|
| PubChem CID | 118401029 |
| Molecular Formula | C16H21N3O4S |
| Molecular Weight | 351.43 g/mol |
| Exact Mass | 351.13 |
| IUPAC Name | (E)-1-cyano-N-(2,3-dihydroxypropyl)-2-(4-morpholin-4-ylphenyl)ethenesulfinamide |
| SMILES | N#C/C(=C\c1ccc(N2CCOCC2)cc1)S(=O)NCC(O)CO |
| InChI | InChI=1S/C16H21N3O4S/c17-10-16(24(22)18-11-15(21)12-20)9-13-1-3-14(4-2-13)19-5-7-23-8-6-19/h1-4,9,15,18,20-21H,5-8,11-12H2/b16-9+ |
| InChIKey | ANNCLIONVKAEFE-CXUHLZMHSA-N |
| XLogP | -0.01 |
| TPSA | 105.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.43 |
| LogP ≤ 5 | -0.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|