C20H27N3O6 — CID 122683876
(E)-2-cyano-3-[4-(diethylamino)phenyl]-N-[(3R,4R,5S,6R)-2,4,5-trihydroxy-6-(hydroxymethyl)oxan-3-yl]prop-2-enamide (PubChem CID 122683876) has the molecular formula C20H27N3O6 and a molecular weight of 405.45 g/mol. Its IUPAC name is (E)-2-cyano-3-[4-(diethylamino)phenyl]-N-[(3R,4R,5S,6R)-2,4,5-trihydroxy-6-(hydroxymethyl)oxan-3-yl]prop-2-enamide.
| Compound Name | (E)-2-cyano-3-[4-(diethylamino)phenyl]-N-[(3R,4R,5S,6R)-2,4,5-trihydroxy-6-(hydroxymethyl)oxan-3-yl]prop-2-enamide |
|---|---|
| PubChem CID | 122683876 |
| Molecular Formula | C20H27N3O6 |
| Molecular Weight | 405.45 g/mol |
| Exact Mass | 405.19 |
| IUPAC Name | (E)-2-cyano-3-[4-(diethylamino)phenyl]-N-[(3R,4R,5S,6R)-2,4,5-trihydroxy-6-(hydroxymethyl)oxan-3-yl]prop-2-enamide |
| SMILES | CCN(CC)c1ccc(/C=C(\C#N)C(=O)N[C@H]2C(O)O[C@H](CO)[C@@H](O)[C@@H]2O)cc1 |
| InChI | InChI=1S/C20H27N3O6/c1-3-23(4-2)14-7-5-12(6-8-14)9-13(10-21)19(27)22-16-18(26)17(25)15(11-24)29-20(16)28/h5-9,15-18,20,24-26,28H,3-4,11H2,1-2H3,(H,22,27)/b13-9+/t15-,16-,17-,18-,20?/m1/s1 |
| InChIKey | RWTNVAILAHPMNX-ZPPLFAJNSA-N |
| XLogP | -0.64 |
| TPSA | 146.28 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.45 |
| LogP ≤ 5 | -0.64 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|