C23H33N3O5 — CID 174112128
(E)-2-cyano-N-[(3R,4R,5S,6R)-4,5-dihydroxy-6-(hydroxymethyl)-2-methyloxan-3-yl]-3-[4-(dipropylamino)phenyl]prop-2-enamide (PubChem CID 174112128) has the molecular formula C23H33N3O5 and a molecular weight of 431.53 g/mol. Its IUPAC name is (E)-2-cyano-N-[(3R,4R,5S,6R)-4,5-dihydroxy-6-(hydroxymethyl)-2-methyloxan-3-yl]-3-[4-(dipropylamino)phenyl]prop-2-enamide.
| Compound Name | (E)-2-cyano-N-[(3R,4R,5S,6R)-4,5-dihydroxy-6-(hydroxymethyl)-2-methyloxan-3-yl]-3-[4-(dipropylamino)phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 174112128 |
| Molecular Formula | C23H33N3O5 |
| Molecular Weight | 431.53 g/mol |
| Exact Mass | 431.24 |
| IUPAC Name | (E)-2-cyano-N-[(3R,4R,5S,6R)-4,5-dihydroxy-6-(hydroxymethyl)-2-methyloxan-3-yl]-3-[4-(dipropylamino)phenyl]prop-2-enamide |
| SMILES | CCCN(CCC)c1ccc(/C=C(\C#N)C(=O)N[C@H]2C(C)O[C@H](CO)[C@@H](O)[C@@H]2O)cc1 |
| InChI | InChI=1S/C23H33N3O5/c1-4-10-26(11-5-2)18-8-6-16(7-9-18)12-17(13-24)23(30)25-20-15(3)31-19(14-27)21(28)22(20)29/h6-9,12,15,19-22,27-29H,4-5,10-11,14H2,1-3H3,(H,25,30)/b17-12+/t15?,19-,20+,21-,22-/m1/s1 |
| InChIKey | SMIKCDWPAFJEFR-GYBIDFKTSA-N |
| XLogP | 1.21 |
| TPSA | 126.05 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.53 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|