C11H21NO5 — CID 57326091
N-[(2S,3R,4R,5R,6R)-4,5-dihydroxy-6-(hydroxymethyl)-2-methyloxan-3-yl]butanamide (PubChem CID 57326091) has the molecular formula C11H21NO5 and a molecular weight of 247.29 g/mol. Its IUPAC name is N-[(2S,3R,4R,5R,6R)-4,5-dihydroxy-6-(hydroxymethyl)-2-methyloxan-3-yl]butanamide.
| Compound Name | N-[(2S,3R,4R,5R,6R)-4,5-dihydroxy-6-(hydroxymethyl)-2-methyloxan-3-yl]butanamide |
|---|---|
| PubChem CID | 57326091 |
| Molecular Formula | C11H21NO5 |
| Molecular Weight | 247.29 g/mol |
| Exact Mass | 247.14 |
| IUPAC Name | N-[(2S,3R,4R,5R,6R)-4,5-dihydroxy-6-(hydroxymethyl)-2-methyloxan-3-yl]butanamide |
| SMILES | CCCC(=O)N[C@@H]1[C@@H](O)[C@@H](O)[C@@H](CO)O[C@H]1C |
| InChI | InChI=1S/C11H21NO5/c1-3-4-8(14)12-9-6(2)17-7(5-13)10(15)11(9)16/h6-7,9-11,13,15-16H,3-5H2,1-2H3,(H,12,14)/t6-,7+,9-,10-,11+/m0/s1 |
| InChIKey | ZDDFJTORPLCPGZ-BNQWIEQOSA-N |
| XLogP | -1.23 |
| TPSA | 99.02 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.29 |
| LogP ≤ 5 | -1.23 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |