C10H19NO5S — CID 91314025
N-[(2S,3S,4R,5S,6R)-4,5-dihydroxy-6-(hydroxymethyl)-2-sulfanyloxan-3-yl]butanamide (PubChem CID 91314025) has the molecular formula C10H19NO5S and a molecular weight of 265.33 g/mol. Its IUPAC name is N-[(2S,3S,4R,5S,6R)-4,5-dihydroxy-6-(hydroxymethyl)-2-sulfanyloxan-3-yl]butanamide.
| Compound Name | N-[(2S,3S,4R,5S,6R)-4,5-dihydroxy-6-(hydroxymethyl)-2-sulfanyloxan-3-yl]butanamide |
|---|---|
| PubChem CID | 91314025 |
| Molecular Formula | C10H19NO5S |
| Molecular Weight | 265.33 g/mol |
| Exact Mass | 265.10 |
| IUPAC Name | N-[(2S,3S,4R,5S,6R)-4,5-dihydroxy-6-(hydroxymethyl)-2-sulfanyloxan-3-yl]butanamide |
| SMILES | CCCC(=O)N[C@H]1[C@@H](O)[C@H](O)[C@@H](CO)O[C@H]1S |
| InChI | InChI=1S/C10H19NO5S/c1-2-3-6(13)11-7-9(15)8(14)5(4-12)16-10(7)17/h5,7-10,12,14-15,17H,2-4H2,1H3,(H,11,13)/t5-,7+,8-,9-,10+/m1/s1 |
| InChIKey | XCUYBVHVCCRGAU-YXCNIWHNSA-N |
| XLogP | -1.36 |
| TPSA | 99.02 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.33 |
| LogP ≤ 5 | -1.36 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|