C20H31NO5 — CID 155119108
N-[4,5-dihydroxy-6-(hydroxymethyl)-2-methyloxan-3-yl]-7-phenylheptanamide (PubChem CID 155119108) has the molecular formula C20H31NO5 and a molecular weight of 365.47 g/mol. Its IUPAC name is N-[4,5-dihydroxy-6-(hydroxymethyl)-2-methyloxan-3-yl]-7-phenylheptanamide.
| Compound Name | N-[4,5-dihydroxy-6-(hydroxymethyl)-2-methyloxan-3-yl]-7-phenylheptanamide |
|---|---|
| PubChem CID | 155119108 |
| Molecular Formula | C20H31NO5 |
| Molecular Weight | 365.47 g/mol |
| Exact Mass | 365.22 |
| IUPAC Name | N-[4,5-dihydroxy-6-(hydroxymethyl)-2-methyloxan-3-yl]-7-phenylheptanamide |
| SMILES | CC1OC(CO)C(O)C(O)C1NC(=O)CCCCCCc1ccccc1 |
| InChI | InChI=1S/C20H31NO5/c1-14-18(20(25)19(24)16(13-22)26-14)21-17(23)12-8-3-2-5-9-15-10-6-4-7-11-15/h4,6-7,10-11,14,16,18-20,22,24-25H,2-3,5,8-9,12-13H2,1H3,(H,21,23) |
| InChIKey | BPYDUMVPXYYXGF-UHFFFAOYSA-N |
| XLogP | 1.17 |
| TPSA | 99.02 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.47 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|