C15H22Ac3ClNO4 — CID 59974131
actinium;(2R)-6-chloro-2-(hydroxymethyl)-5-(3-phenylpropylamino)oxane-3,4-diol (PubChem CID 59974131) has the molecular formula C15H22Ac3ClNO4 and a molecular weight of 996.80 g/mol. Its IUPAC name is actinium;(2R)-6-chloro-2-(hydroxymethyl)-5-(3-phenylpropylamino)oxane-3,4-diol.
| Compound Name | actinium;(2R)-6-chloro-2-(hydroxymethyl)-5-(3-phenylpropylamino)oxane-3,4-diol |
|---|---|
| PubChem CID | 59974131 |
| Molecular Formula | C15H22Ac3ClNO4 |
| Molecular Weight | 996.80 g/mol |
| Exact Mass | 996.21 |
| IUPAC Name | actinium;(2R)-6-chloro-2-(hydroxymethyl)-5-(3-phenylpropylamino)oxane-3,4-diol |
| SMILES | OC[C@H]1OC(Cl)C(NCCCc2ccccc2)C(O)C1O.[Ac].[Ac].[Ac] |
| InChI | InChI=1S/C15H22ClNO4.3Ac/c16-15-12(14(20)13(19)11(9-18)21-15)17-8-4-7-10-5-2-1-3-6-10;;;/h1-3,5-6,11-15,17-20H,4,7-9H2;;;/t11-,12?,13?,14?,15?;;;/m1.../s1 |
| InChIKey | SOTDBVSYRGKNFR-JIOXZZRZSA-N |
| XLogP | 0.26 |
| TPSA | 81.95 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 996.80 |
| LogP ≤ 5 | 0.26 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|