C15H23NO4 — CID 177464578
(1S,2S,3S,4R,5R)-4-(hydroxymethyl)-5-(3-phenylpropylamino)cyclopentane-1,2,3-triol (PubChem CID 177464578) has the molecular formula C15H23NO4 and a molecular weight of 281.35 g/mol. Its IUPAC name is (1S,2S,3S,4R,5R)-4-(hydroxymethyl)-5-(3-phenylpropylamino)cyclopentane-1,2,3-triol.
| Compound Name | (1S,2S,3S,4R,5R)-4-(hydroxymethyl)-5-(3-phenylpropylamino)cyclopentane-1,2,3-triol |
|---|---|
| PubChem CID | 177464578 |
| Molecular Formula | C15H23NO4 |
| Molecular Weight | 281.35 g/mol |
| Exact Mass | 281.16 |
| IUPAC Name | (1S,2S,3S,4R,5R)-4-(hydroxymethyl)-5-(3-phenylpropylamino)cyclopentane-1,2,3-triol |
| SMILES | OC[C@@H]1[C@H](O)[C@H](O)[C@@H](O)[C@@H]1NCCCc1ccccc1 |
| InChI | InChI=1S/C15H23NO4/c17-9-11-12(14(19)15(20)13(11)18)16-8-4-7-10-5-2-1-3-6-10/h1-3,5-6,11-20H,4,7-9H2/t11-,12+,13-,14-,15-/m0/s1 |
| InChIKey | FLOOUOGABLTURF-AICCOOGYSA-N |
| XLogP | -0.72 |
| TPSA | 92.95 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.35 |
| LogP ≤ 5 | -0.72 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|