C15H23NO — CID 112633261
2,2-dimethyl-3-(3-phenylpropylamino)cyclobutan-1-ol (PubChem CID 112633261) has the molecular formula C15H23NO and a molecular weight of 233.35 g/mol. Its IUPAC name is 2,2-dimethyl-3-(3-phenylpropylamino)cyclobutan-1-ol.
| Compound Name | 2,2-dimethyl-3-(3-phenylpropylamino)cyclobutan-1-ol |
|---|---|
| PubChem CID | 112633261 |
| Molecular Formula | C15H23NO |
| Molecular Weight | 233.35 g/mol |
| Exact Mass | 233.18 |
| IUPAC Name | 2,2-dimethyl-3-(3-phenylpropylamino)cyclobutan-1-ol |
| SMILES | CC1(C)C(O)CC1NCCCc1ccccc1 |
| InChI | InChI=1S/C15H23NO/c1-15(2)13(11-14(15)17)16-10-6-9-12-7-4-3-5-8-12/h3-5,7-8,13-14,16-17H,6,9-11H2,1-2H3 |
| InChIKey | HXMGNOOQKKHRFS-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.35 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|