C12H25NOS — CID 104926456
2,2-dimethyl-3-(5-methylsulfanylpentylamino)cyclobutan-1-ol (PubChem CID 104926456) has the molecular formula C12H25NOS and a molecular weight of 231.40 g/mol. Its IUPAC name is 2,2-dimethyl-3-(5-methylsulfanylpentylamino)cyclobutan-1-ol.
| Compound Name | 2,2-dimethyl-3-(5-methylsulfanylpentylamino)cyclobutan-1-ol |
|---|---|
| PubChem CID | 104926456 |
| Molecular Formula | C12H25NOS |
| Molecular Weight | 231.40 g/mol |
| Exact Mass | 231.17 |
| IUPAC Name | 2,2-dimethyl-3-(5-methylsulfanylpentylamino)cyclobutan-1-ol |
| SMILES | CSCCCCCNC1CC(O)C1(C)C |
| InChI | InChI=1S/C12H25NOS/c1-12(2)10(9-11(12)14)13-7-5-4-6-8-15-3/h10-11,13-14H,4-9H2,1-3H3 |
| InChIKey | BCCGNCCKBJWRGE-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.40 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|