C9H19NO2 — CID 112633105
3-(2-methoxyethylamino)-2,2-dimethylcyclobutan-1-ol (PubChem CID 112633105) has the molecular formula C9H19NO2 and a molecular weight of 173.26 g/mol. Its IUPAC name is 3-(2-methoxyethylamino)-2,2-dimethylcyclobutan-1-ol.
| Compound Name | 3-(2-methoxyethylamino)-2,2-dimethylcyclobutan-1-ol |
|---|---|
| PubChem CID | 112633105 |
| Molecular Formula | C9H19NO2 |
| Molecular Weight | 173.26 g/mol |
| Exact Mass | 173.14 |
| IUPAC Name | 3-(2-methoxyethylamino)-2,2-dimethylcyclobutan-1-ol |
| SMILES | COCCNC1CC(O)C1(C)C |
| InChI | InChI=1S/C9H19NO2/c1-9(2)7(6-8(9)11)10-4-5-12-3/h7-8,10-11H,4-6H2,1-3H3 |
| InChIKey | PXXURDVQLKRUBQ-UHFFFAOYSA-N |
| XLogP | 0.38 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 173.26 |
| LogP ≤ 5 | 0.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|