C7H15NO2 — CID 112634239
3-(methoxyamino)-2,2-dimethylcyclobutan-1-ol (PubChem CID 112634239) has the molecular formula C7H15NO2 and a molecular weight of 145.20 g/mol. Its IUPAC name is 3-(methoxyamino)-2,2-dimethylcyclobutan-1-ol.
| Compound Name | 3-(methoxyamino)-2,2-dimethylcyclobutan-1-ol |
|---|---|
| PubChem CID | 112634239 |
| Molecular Formula | C7H15NO2 |
| Molecular Weight | 145.20 g/mol |
| Exact Mass | 145.11 |
| IUPAC Name | 3-(methoxyamino)-2,2-dimethylcyclobutan-1-ol |
| SMILES | CONC1CC(O)C1(C)C |
| InChI | InChI=1S/C7H15NO2/c1-7(2)5(8-10-3)4-6(7)9/h5-6,8-9H,4H2,1-3H3 |
| InChIKey | YHELEGKSRLULDS-UHFFFAOYSA-N |
| XLogP | 0.30 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 145.20 |
| LogP ≤ 5 | 0.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|