C19H29N — CID 141314175
(1S,2S,3S,5R)-2,6,6-trimethyl-N-(3-phenylpropyl)bicyclo[3.1.1]heptan-3-amine (PubChem CID 141314175) has the molecular formula C19H29N and a molecular weight of 271.45 g/mol. Its IUPAC name is (1S,2S,3S,5R)-2,6,6-trimethyl-N-(3-phenylpropyl)bicyclo[3.1.1]heptan-3-amine.
| Compound Name | (1S,2S,3S,5R)-2,6,6-trimethyl-N-(3-phenylpropyl)bicyclo[3.1.1]heptan-3-amine |
|---|---|
| PubChem CID | 141314175 |
| Molecular Formula | C19H29N |
| Molecular Weight | 271.45 g/mol |
| Exact Mass | 271.23 |
| IUPAC Name | (1S,2S,3S,5R)-2,6,6-trimethyl-N-(3-phenylpropyl)bicyclo[3.1.1]heptan-3-amine |
| SMILES | C[C@@H]1[C@@H](NCCCc2ccccc2)C[C@H]2C[C@@H]1C2(C)C |
| InChI | InChI=1S/C19H29N/c1-14-17-12-16(19(17,2)3)13-18(14)20-11-7-10-15-8-5-4-6-9-15/h4-6,8-9,14,16-18,20H,7,10-13H2,1-3H3/t14-,16+,17-,18-/m0/s1 |
| InChIKey | CKLBRIRSFHYONZ-RANZSIQMSA-N |
| XLogP | 4.28 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.45 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|