C25H32BrN3O2 — CID 59574694
4-bromo-2-(2-oxo-5-phenylpentyl)-5-[[(1S,2R,3R,5R)-2,6,6-trimethyl-3-bicyclo[3.1.1]heptanyl]amino]pyridazin-3-one (PubChem CID 59574694) has the molecular formula C25H32BrN3O2 and a molecular weight of 486.45 g/mol. Its IUPAC name is 4-bromo-2-(2-oxo-5-phenylpentyl)-5-[[(1S,2R,3R,5R)-2,6,6-trimethyl-3-bicyclo[3.1.1]heptanyl]amino]pyridazin-3-one.
| Compound Name | 4-bromo-2-(2-oxo-5-phenylpentyl)-5-[[(1S,2R,3R,5R)-2,6,6-trimethyl-3-bicyclo[3.1.1]heptanyl]amino]pyridazin-3-one |
|---|---|
| PubChem CID | 59574694 |
| Molecular Formula | C25H32BrN3O2 |
| Molecular Weight | 486.45 g/mol |
| Exact Mass | 485.17 |
| IUPAC Name | 4-bromo-2-(2-oxo-5-phenylpentyl)-5-[[(1S,2R,3R,5R)-2,6,6-trimethyl-3-bicyclo[3.1.1]heptanyl]amino]pyridazin-3-one |
| SMILES | C[C@H]1[C@H](Nc2cnn(CC(=O)CCCc3ccccc3)c(=O)c2Br)C[C@H]2C[C@@H]1C2(C)C |
| InChI | InChI=1S/C25H32BrN3O2/c1-16-20-12-18(25(20,2)3)13-21(16)28-22-14-27-29(24(31)23(22)26)15-19(30)11-7-10-17-8-5-4-6-9-17/h4-6,8-9,14,16,18,20-21,28H,7,10-13,15H2,1-3H3/t16-,18-,20+,21-/m1/s1 |
| InChIKey | FHNDMWPPDIVACK-FRTACKCFSA-N |
| XLogP | 5.08 |
| TPSA | 63.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.45 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |