C23H24BrF4N3O2 — CID 59574711
4-bromo-2-[2-[3-fluoro-4-(trifluoromethyl)phenyl]-2-oxoethyl]-5-[[(1S,2R,3R,5R)-2,6,6-trimethyl-3-bicyclo[3.1.1]heptanyl]amino]pyridazin-3-one (PubChem CID 59574711) has the molecular formula C23H24BrF4N3O2 and a molecular weight of 530.36 g/mol. Its IUPAC name is 4-bromo-2-[2-[3-fluoro-4-(trifluoromethyl)phenyl]-2-oxoethyl]-5-[[(1S,2R,3R,5R)-2,6,6-trimethyl-3-bicyclo[3.1.1]heptanyl]amino]pyridazin-3-one.
| Compound Name | 4-bromo-2-[2-[3-fluoro-4-(trifluoromethyl)phenyl]-2-oxoethyl]-5-[[(1S,2R,3R,5R)-2,6,6-trimethyl-3-bicyclo[3.1.1]heptanyl]amino]pyridazin-3-one |
|---|---|
| PubChem CID | 59574711 |
| Molecular Formula | C23H24BrF4N3O2 |
| Molecular Weight | 530.36 g/mol |
| Exact Mass | 529.10 |
| IUPAC Name | 4-bromo-2-[2-[3-fluoro-4-(trifluoromethyl)phenyl]-2-oxoethyl]-5-[[(1S,2R,3R,5R)-2,6,6-trimethyl-3-bicyclo[3.1.1]heptanyl]amino]pyridazin-3-one |
| SMILES | C[C@H]1[C@H](Nc2cnn(CC(=O)c3ccc(C(F)(F)F)c(F)c3)c(=O)c2Br)C[C@H]2C[C@@H]1C2(C)C |
| InChI | InChI=1S/C23H24BrF4N3O2/c1-11-15-7-13(22(15,2)3)8-17(11)30-18-9-29-31(21(33)20(18)24)10-19(32)12-4-5-14(16(25)6-12)23(26,27)28/h4-6,9,11,13,15,17,30H,7-8,10H2,1-3H3/t11-,13-,15+,17-/m1/s1 |
| InChIKey | ALICYNXURCZVNL-JSHWQEIDSA-N |
| XLogP | 5.53 |
| TPSA | 63.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.36 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |