C24H27BrF4N4O2 — CID 59574135
2-[5-bromo-6-oxo-4-[[(1S,2R,3R,5R)-2,6,6-trimethyl-3-bicyclo[3.1.1]heptanyl]amino]pyridazin-1-yl]-N-[[3-fluoro-4-(trifluoromethyl)phenyl]methyl]acetamide (PubChem CID 59574135) has the molecular formula C24H27BrF4N4O2 and a molecular weight of 559.40 g/mol. Its IUPAC name is 2-[5-bromo-6-oxo-4-[[(1S,2R,3R,5R)-2,6,6-trimethyl-3-bicyclo[3.1.1]heptanyl]amino]pyridazin-1-yl]-N-[[3-fluoro-4-(trifluoromethyl)phenyl]methyl]acetamide.
| Compound Name | 2-[5-bromo-6-oxo-4-[[(1S,2R,3R,5R)-2,6,6-trimethyl-3-bicyclo[3.1.1]heptanyl]amino]pyridazin-1-yl]-N-[[3-fluoro-4-(trifluoromethyl)phenyl]methyl]acetamide |
|---|---|
| PubChem CID | 59574135 |
| Molecular Formula | C24H27BrF4N4O2 |
| Molecular Weight | 559.40 g/mol |
| Exact Mass | 558.13 |
| IUPAC Name | 2-[5-bromo-6-oxo-4-[[(1S,2R,3R,5R)-2,6,6-trimethyl-3-bicyclo[3.1.1]heptanyl]amino]pyridazin-1-yl]-N-[[3-fluoro-4-(trifluoromethyl)phenyl]methyl]acetamide |
| SMILES | C[C@H]1[C@H](Nc2cnn(CC(=O)NCc3ccc(C(F)(F)F)c(F)c3)c(=O)c2Br)C[C@H]2C[C@@H]1C2(C)C |
| InChI | InChI=1S/C24H27BrF4N4O2/c1-12-16-7-14(23(16,2)3)8-18(12)32-19-10-31-33(22(35)21(19)25)11-20(34)30-9-13-4-5-15(17(26)6-13)24(27,28)29/h4-6,10,12,14,16,18,32H,7-9,11H2,1-3H3,(H,30,34)/t12-,14-,16+,18-/m1/s1 |
| InChIKey | NULXJXNEXNCLKD-JDIZFGSQSA-N |
| XLogP | 4.96 |
| TPSA | 76.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.40 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |