C17H24ClN — CID 155105315
(1S,2S,3S,5R)-N-[(3-chlorophenyl)methyl]-2,6,6-trimethylbicyclo[3.1.1]heptan-3-amine (PubChem CID 155105315) has the molecular formula C17H24ClN and a molecular weight of 277.84 g/mol. Its IUPAC name is (1S,2S,3S,5R)-N-[(3-chlorophenyl)methyl]-2,6,6-trimethylbicyclo[3.1.1]heptan-3-amine.
| Compound Name | (1S,2S,3S,5R)-N-[(3-chlorophenyl)methyl]-2,6,6-trimethylbicyclo[3.1.1]heptan-3-amine |
|---|---|
| PubChem CID | 155105315 |
| Molecular Formula | C17H24ClN |
| Molecular Weight | 277.84 g/mol |
| Exact Mass | 277.16 |
| IUPAC Name | (1S,2S,3S,5R)-N-[(3-chlorophenyl)methyl]-2,6,6-trimethylbicyclo[3.1.1]heptan-3-amine |
| SMILES | C[C@@H]1[C@@H](NCc2cccc(Cl)c2)C[C@H]2C[C@@H]1C2(C)C |
| InChI | InChI=1S/C17H24ClN/c1-11-15-8-13(17(15,2)3)9-16(11)19-10-12-5-4-6-14(18)7-12/h4-7,11,13,15-16,19H,8-10H2,1-3H3/t11-,13+,15-,16-/m0/s1 |
| InChIKey | GCVDAPXBXSZZBP-YOENINGUSA-N |
| XLogP | 4.50 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.84 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |