C18H16Cl2N2O2 — CID 167996876
3,4-bis[(3-chlorophenyl)methylamino]cyclobutane-1,2-dione (PubChem CID 167996876) has the molecular formula C18H16Cl2N2O2 and a molecular weight of 363.24 g/mol. Its IUPAC name is 3,4-bis[(3-chlorophenyl)methylamino]cyclobutane-1,2-dione.
| Compound Name | 3,4-bis[(3-chlorophenyl)methylamino]cyclobutane-1,2-dione |
|---|---|
| PubChem CID | 167996876 |
| Molecular Formula | C18H16Cl2N2O2 |
| Molecular Weight | 363.24 g/mol |
| Exact Mass | 362.06 |
| IUPAC Name | 3,4-bis[(3-chlorophenyl)methylamino]cyclobutane-1,2-dione |
| SMILES | O=C1C(=O)C(NCc2cccc(Cl)c2)C1NCc1cccc(Cl)c1 |
| InChI | InChI=1S/C18H16Cl2N2O2/c19-13-5-1-3-11(7-13)9-21-15-16(18(24)17(15)23)22-10-12-4-2-6-14(20)8-12/h1-8,15-16,21-22H,9-10H2 |
| InChIKey | AMGUTCNGUFCFQY-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.24 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|