C28H33NO6P+ — CID 101349422
[4-oxo-4-[[(3R,4R,5S,6R)-2,4,5-trihydroxy-6-(hydroxymethyl)oxan-3-yl]amino]butyl]-triphenylphosphanium (PubChem CID 101349422) has the molecular formula C28H33NO6P+ and a molecular weight of 510.55 g/mol. Its IUPAC name is [4-oxo-4-[[(3R,4R,5S,6R)-2,4,5-trihydroxy-6-(hydroxymethyl)oxan-3-yl]amino]butyl]-triphenylphosphanium.
| Compound Name | [4-oxo-4-[[(3R,4R,5S,6R)-2,4,5-trihydroxy-6-(hydroxymethyl)oxan-3-yl]amino]butyl]-triphenylphosphanium |
|---|---|
| PubChem CID | 101349422 |
| Molecular Formula | C28H33NO6P+ |
| Molecular Weight | 510.55 g/mol |
| Exact Mass | 510.20 |
| IUPAC Name | [4-oxo-4-[[(3R,4R,5S,6R)-2,4,5-trihydroxy-6-(hydroxymethyl)oxan-3-yl]amino]butyl]-triphenylphosphanium |
| SMILES | O=C(CCC[P+](c1ccccc1)(c1ccccc1)c1ccccc1)N[C@H]1C(O)O[C@H](CO)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C28H32NO6P/c30-19-23-26(32)27(33)25(28(34)35-23)29-24(31)17-10-18-36(20-11-4-1-5-12-20,21-13-6-2-7-14-21)22-15-8-3-9-16-22/h1-9,11-16,23,25-28,30,32-34H,10,17-19H2/p+1/t23-,25-,26-,27-,28?/m1/s1 |
| InChIKey | OGKNJXJCAKAHIY-KICATWCFSA-O |
| XLogP | 0.68 |
| TPSA | 119.25 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.55 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|