C16H22N2O8S — CID 3678684
4-(2-nitrophenyl)sulfanyl-N-[2,4,5-trihydroxy-6-(hydroxymethyl)oxan-3-yl]butanamide (PubChem CID 3678684) has the molecular formula C16H22N2O8S and a molecular weight of 402.43 g/mol. Its IUPAC name is 4-(2-nitrophenyl)sulfanyl-N-[2,4,5-trihydroxy-6-(hydroxymethyl)oxan-3-yl]butanamide.
| Compound Name | 4-(2-nitrophenyl)sulfanyl-N-[2,4,5-trihydroxy-6-(hydroxymethyl)oxan-3-yl]butanamide |
|---|---|
| PubChem CID | 3678684 |
| Molecular Formula | C16H22N2O8S |
| Molecular Weight | 402.43 g/mol |
| Exact Mass | 402.11 |
| IUPAC Name | 4-(2-nitrophenyl)sulfanyl-N-[2,4,5-trihydroxy-6-(hydroxymethyl)oxan-3-yl]butanamide |
| SMILES | O=C(CCCSc1ccccc1[N+](=O)[O-])NC1C(O)OC(CO)C(O)C1O |
| InChI | InChI=1S/C16H22N2O8S/c19-8-10-14(21)15(22)13(16(23)26-10)17-12(20)6-3-7-27-11-5-2-1-4-9(11)18(24)25/h1-2,4-5,10,13-16,19,21-23H,3,6-8H2,(H,17,20) |
| InChIKey | SDYARGLMKXJOGP-UHFFFAOYSA-N |
| XLogP | -0.62 |
| TPSA | 162.39 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.43 |
| LogP ≤ 5 | -0.62 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|