C22H25N3O4 — CID 144928295
(E)-2-cyano-N-[(4,6-dihydroxyoxan-2-yl)methyl]-3-[6-(dimethylamino)naphthalen-2-yl]prop-2-enamide (PubChem CID 144928295) has the molecular formula C22H25N3O4 and a molecular weight of 395.46 g/mol. Its IUPAC name is (E)-2-cyano-N-[(4,6-dihydroxyoxan-2-yl)methyl]-3-[6-(dimethylamino)naphthalen-2-yl]prop-2-enamide.
| Compound Name | (E)-2-cyano-N-[(4,6-dihydroxyoxan-2-yl)methyl]-3-[6-(dimethylamino)naphthalen-2-yl]prop-2-enamide |
|---|---|
| PubChem CID | 144928295 |
| Molecular Formula | C22H25N3O4 |
| Molecular Weight | 395.46 g/mol |
| Exact Mass | 395.18 |
| IUPAC Name | (E)-2-cyano-N-[(4,6-dihydroxyoxan-2-yl)methyl]-3-[6-(dimethylamino)naphthalen-2-yl]prop-2-enamide |
| SMILES | CN(C)c1ccc2cc(/C=C(\C#N)C(=O)NCC3CC(O)CC(O)O3)ccc2c1 |
| InChI | InChI=1S/C22H25N3O4/c1-25(2)18-6-5-15-7-14(3-4-16(15)9-18)8-17(12-23)22(28)24-13-20-10-19(26)11-21(27)29-20/h3-9,19-21,26-27H,10-11,13H2,1-2H3,(H,24,28)/b17-8+ |
| InChIKey | FUULPSKYXXBKQQ-CAOOACKPSA-N |
| XLogP | 1.79 |
| TPSA | 105.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.46 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|