C25H37N3O2 — CID 156709191
butan-1-ol;(E)-2-cyano-3-[6-(dimethylamino)naphthalen-2-yl]-N-methylprop-2-enamide;2-methylpropane (PubChem CID 156709191) has the molecular formula C25H37N3O2 and a molecular weight of 411.59 g/mol. Its IUPAC name is butan-1-ol;(E)-2-cyano-3-[6-(dimethylamino)naphthalen-2-yl]-N-methylprop-2-enamide;2-methylpropane.
| Compound Name | butan-1-ol;(E)-2-cyano-3-[6-(dimethylamino)naphthalen-2-yl]-N-methylprop-2-enamide;2-methylpropane |
|---|---|
| PubChem CID | 156709191 |
| Molecular Formula | C25H37N3O2 |
| Molecular Weight | 411.59 g/mol |
| Exact Mass | 411.29 |
| IUPAC Name | butan-1-ol;(E)-2-cyano-3-[6-(dimethylamino)naphthalen-2-yl]-N-methylprop-2-enamide;2-methylpropane |
| SMILES | CC(C)C.CCCCO.CNC(=O)/C(C#N)=C/c1ccc2cc(N(C)C)ccc2c1 |
| InChI | InChI=1S/C17H17N3O.C4H10O.C4H10/c1-19-17(21)15(11-18)9-12-4-5-14-10-16(20(2)3)7-6-13(14)8-12;1-2-3-4-5;1-4(2)3/h4-10H,1-3H3,(H,19,21);5H,2-4H2,1H3;4H,1-3H3/b15-9+;; |
| InChIKey | VNGMOEFITAKCHO-CBNWXSEKSA-N |
| XLogP | 5.00 |
| TPSA | 76.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.59 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|