C22H27N3O6S — CID 122682666
(E)-1-cyano-2-[6-(dimethylamino)naphthalen-2-yl]-N-[(3R,4R,5S,6R)-6-ethyl-2,4,5-trihydroxyoxan-3-yl]ethenesulfonamide (PubChem CID 122682666) has the molecular formula C22H27N3O6S and a molecular weight of 461.54 g/mol. Its IUPAC name is (E)-1-cyano-2-[6-(dimethylamino)naphthalen-2-yl]-N-[(3R,4R,5S,6R)-6-ethyl-2,4,5-trihydroxyoxan-3-yl]ethenesulfonamide.
| Compound Name | (E)-1-cyano-2-[6-(dimethylamino)naphthalen-2-yl]-N-[(3R,4R,5S,6R)-6-ethyl-2,4,5-trihydroxyoxan-3-yl]ethenesulfonamide |
|---|---|
| PubChem CID | 122682666 |
| Molecular Formula | C22H27N3O6S |
| Molecular Weight | 461.54 g/mol |
| Exact Mass | 461.16 |
| IUPAC Name | (E)-1-cyano-2-[6-(dimethylamino)naphthalen-2-yl]-N-[(3R,4R,5S,6R)-6-ethyl-2,4,5-trihydroxyoxan-3-yl]ethenesulfonamide |
| SMILES | CC[C@H]1OC(O)[C@H](NS(=O)(=O)/C(C#N)=C/c2ccc3cc(N(C)C)ccc3c2)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C22H27N3O6S/c1-4-18-20(26)21(27)19(22(28)31-18)24-32(29,30)17(12-23)10-13-5-6-15-11-16(25(2)3)8-7-14(15)9-13/h5-11,18-22,24,26-28H,4H2,1-3H3/b17-10+/t18-,19-,20-,21-,22?/m1/s1 |
| InChIKey | MXSLXPAOYHHPOZ-OCOKAUNFSA-N |
| XLogP | 0.91 |
| TPSA | 143.12 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.54 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|