C18H25N3O7S — CID 130375220
(E)-1-cyano-2-[4-(dimethylamino)phenyl]-N-[(3R,4R,5S,6R)-2,4,5-trihydroxy-6-(hydroxymethyl)oxan-3-yl]prop-1-ene-1-sulfonamide (PubChem CID 130375220) has the molecular formula C18H25N3O7S and a molecular weight of 427.48 g/mol. Its IUPAC name is (E)-1-cyano-2-[4-(dimethylamino)phenyl]-N-[(3R,4R,5S,6R)-2,4,5-trihydroxy-6-(hydroxymethyl)oxan-3-yl]prop-1-ene-1-sulfonamide.
| Compound Name | (E)-1-cyano-2-[4-(dimethylamino)phenyl]-N-[(3R,4R,5S,6R)-2,4,5-trihydroxy-6-(hydroxymethyl)oxan-3-yl]prop-1-ene-1-sulfonamide |
|---|---|
| PubChem CID | 130375220 |
| Molecular Formula | C18H25N3O7S |
| Molecular Weight | 427.48 g/mol |
| Exact Mass | 427.14 |
| IUPAC Name | (E)-1-cyano-2-[4-(dimethylamino)phenyl]-N-[(3R,4R,5S,6R)-2,4,5-trihydroxy-6-(hydroxymethyl)oxan-3-yl]prop-1-ene-1-sulfonamide |
| SMILES | C/C(=C(/C#N)S(=O)(=O)N[C@H]1C(O)O[C@H](CO)[C@@H](O)[C@@H]1O)c1ccc(N(C)C)cc1 |
| InChI | InChI=1S/C18H25N3O7S/c1-10(11-4-6-12(7-5-11)21(2)3)14(8-19)29(26,27)20-15-17(24)16(23)13(9-22)28-18(15)25/h4-7,13,15-18,20,22-25H,9H2,1-3H3/b14-10+/t13-,15-,16-,17-,18?/m1/s1 |
| InChIKey | LDZPFZDJKVXKRC-SGMANSOCSA-N |
| XLogP | -1.27 |
| TPSA | 163.35 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.48 |
| LogP ≤ 5 | -1.27 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|