C27H29N3O5S — CID 122682913
(E)-2-cyano-3-[5-[6-(dimethylamino)naphthalen-2-yl]thiophen-2-yl]-N-[[(2R,3S,4R,5R)-3,4,6-trihydroxy-5-methyloxan-2-yl]methyl]prop-2-enamide (PubChem CID 122682913) has the molecular formula C27H29N3O5S and a molecular weight of 507.61 g/mol. Its IUPAC name is (E)-2-cyano-3-[5-[6-(dimethylamino)naphthalen-2-yl]thiophen-2-yl]-N-[[(2R,3S,4R,5R)-3,4,6-trihydroxy-5-methyloxan-2-yl]methyl]prop-2-enamide.
| Compound Name | (E)-2-cyano-3-[5-[6-(dimethylamino)naphthalen-2-yl]thiophen-2-yl]-N-[[(2R,3S,4R,5R)-3,4,6-trihydroxy-5-methyloxan-2-yl]methyl]prop-2-enamide |
|---|---|
| PubChem CID | 122682913 |
| Molecular Formula | C27H29N3O5S |
| Molecular Weight | 507.61 g/mol |
| Exact Mass | 507.18 |
| IUPAC Name | (E)-2-cyano-3-[5-[6-(dimethylamino)naphthalen-2-yl]thiophen-2-yl]-N-[[(2R,3S,4R,5R)-3,4,6-trihydroxy-5-methyloxan-2-yl]methyl]prop-2-enamide |
| SMILES | C[C@H]1C(O)O[C@H](CNC(=O)/C(C#N)=C/c2ccc(-c3ccc4cc(N(C)C)ccc4c3)s2)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C27H29N3O5S/c1-15-24(31)25(32)22(35-27(15)34)14-29-26(33)19(13-28)12-21-8-9-23(36-21)18-5-4-17-11-20(30(2)3)7-6-16(17)10-18/h4-12,15,22,24-25,27,31-32,34H,14H2,1-3H3,(H,29,33)/b19-12+/t15-,22-,24-,25-,27?/m1/s1 |
| InChIKey | BWVIKDZVLPTZCE-IPKTVSDRSA-N |
| XLogP | 2.73 |
| TPSA | 126.05 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.61 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|