C40H31N3O2S — CID 90457432
(E)-2-cyano-3-[5-[9,9-diethyl-7-(N-naphthalen-2-ylanilino)fluoren-2-yl]-1,3-thiazol-2-yl]prop-2-enoic acid (PubChem CID 90457432) has the molecular formula C40H31N3O2S and a molecular weight of 617.77 g/mol. Its IUPAC name is (E)-2-cyano-3-[5-[9,9-diethyl-7-(N-naphthalen-2-ylanilino)fluoren-2-yl]-1,3-thiazol-2-yl]prop-2-enoic acid.
| Compound Name | (E)-2-cyano-3-[5-[9,9-diethyl-7-(N-naphthalen-2-ylanilino)fluoren-2-yl]-1,3-thiazol-2-yl]prop-2-enoic acid |
|---|---|
| PubChem CID | 90457432 |
| Molecular Formula | C40H31N3O2S |
| Molecular Weight | 617.77 g/mol |
| Exact Mass | 617.21 |
| IUPAC Name | (E)-2-cyano-3-[5-[9,9-diethyl-7-(N-naphthalen-2-ylanilino)fluoren-2-yl]-1,3-thiazol-2-yl]prop-2-enoic acid |
| SMILES | CCC1(CC)c2cc(-c3cnc(/C=C(\C#N)C(=O)O)s3)ccc2-c2ccc(N(c3ccccc3)c3ccc4ccccc4c3)cc21 |
| InChI | InChI=1S/C40H31N3O2S/c1-3-40(4-2)35-21-28(37-25-42-38(46-37)22-29(24-41)39(44)45)15-18-33(35)34-19-17-32(23-36(34)40)43(30-12-6-5-7-13-30)31-16-14-26-10-8-9-11-27(26)20-31/h5-23,25H,3-4H2,1-2H3,(H,44,45)/b29-22+ |
| InChIKey | CWKXTHPLBPUCLC-QUPMIFSKSA-N |
| XLogP | 10.51 |
| TPSA | 77.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 617.77 |
| LogP ≤ 5 | 10.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|