C37H30N2O2 — CID 90403851
2-cyano-3-[1-ethyl-9,9-dimethyl-7-(N-naphthalen-2-ylanilino)fluoren-2-yl]prop-2-enoic acid (PubChem CID 90403851) has the molecular formula C37H30N2O2 and a molecular weight of 534.66 g/mol. Its IUPAC name is 2-cyano-3-[1-ethyl-9,9-dimethyl-7-(N-naphthalen-2-ylanilino)fluoren-2-yl]prop-2-enoic acid.
| Compound Name | 2-cyano-3-[1-ethyl-9,9-dimethyl-7-(N-naphthalen-2-ylanilino)fluoren-2-yl]prop-2-enoic acid |
|---|---|
| PubChem CID | 90403851 |
| Molecular Formula | C37H30N2O2 |
| Molecular Weight | 534.66 g/mol |
| Exact Mass | 534.23 |
| IUPAC Name | 2-cyano-3-[1-ethyl-9,9-dimethyl-7-(N-naphthalen-2-ylanilino)fluoren-2-yl]prop-2-enoic acid |
| SMILES | CCc1c(C=C(C#N)C(=O)O)ccc2c1C(C)(C)c1cc(N(c3ccccc3)c3ccc4ccccc4c3)ccc1-2 |
| InChI | InChI=1S/C37H30N2O2/c1-4-31-26(20-27(23-38)36(40)41)15-18-33-32-19-17-30(22-34(32)37(2,3)35(31)33)39(28-12-6-5-7-13-28)29-16-14-24-10-8-9-11-25(24)21-29/h5-22H,4H2,1-3H3,(H,40,41) |
| InChIKey | CCVKBMDYKUKZAK-UHFFFAOYSA-N |
| XLogP | 9.17 |
| TPSA | 64.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.66 |
| LogP ≤ 5 | 9.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|