C50H39N3O2S — CID 143793361
(Z)-3-[5-[3,5-bis(3,5-dimethyl-N-naphthalen-1-ylanilino)phenyl]thiophen-2-yl]-2-cyanoprop-2-enoic acid (PubChem CID 143793361) has the molecular formula C50H39N3O2S and a molecular weight of 745.95 g/mol. Its IUPAC name is (Z)-3-[5-[3,5-bis(3,5-dimethyl-N-naphthalen-1-ylanilino)phenyl]thiophen-2-yl]-2-cyanoprop-2-enoic acid.
| Compound Name | (Z)-3-[5-[3,5-bis(3,5-dimethyl-N-naphthalen-1-ylanilino)phenyl]thiophen-2-yl]-2-cyanoprop-2-enoic acid |
|---|---|
| PubChem CID | 143793361 |
| Molecular Formula | C50H39N3O2S |
| Molecular Weight | 745.95 g/mol |
| Exact Mass | 745.28 |
| IUPAC Name | (Z)-3-[5-[3,5-bis(3,5-dimethyl-N-naphthalen-1-ylanilino)phenyl]thiophen-2-yl]-2-cyanoprop-2-enoic acid |
| SMILES | Cc1cc(C)cc(N(c2cc(-c3ccc(/C=C(/C#N)C(=O)O)s3)cc(N(c3cc(C)cc(C)c3)c3cccc4ccccc34)c2)c2cccc3ccccc23)c1 |
| InChI | InChI=1S/C50H39N3O2S/c1-32-21-33(2)24-40(23-32)52(47-17-9-13-36-11-5-7-15-45(36)47)42-27-38(49-20-19-44(56-49)29-39(31-51)50(54)55)28-43(30-42)53(41-25-34(3)22-35(4)26-41)48-18-10-14-37-12-6-8-16-46(37)48/h5-30H,1-4H3,(H,54,55)/b39-29- |
| InChIKey | MJHSEBXXCHNBIT-RGINJTCGSA-N |
| XLogP | 13.89 |
| TPSA | 67.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 745.95 |
| LogP ≤ 5 | 13.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|