C50H41N3S — CID 143793459
(E)-3-[5-[3,5-bis(2,4-dimethyl-N-naphthalen-1-ylanilino)phenyl]thiophen-2-yl]-2-methylprop-2-enenitrile (PubChem CID 143793459) has the molecular formula C50H41N3S and a molecular weight of 715.97 g/mol. Its IUPAC name is (E)-3-[5-[3,5-bis(2,4-dimethyl-N-naphthalen-1-ylanilino)phenyl]thiophen-2-yl]-2-methylprop-2-enenitrile.
| Compound Name | (E)-3-[5-[3,5-bis(2,4-dimethyl-N-naphthalen-1-ylanilino)phenyl]thiophen-2-yl]-2-methylprop-2-enenitrile |
|---|---|
| PubChem CID | 143793459 |
| Molecular Formula | C50H41N3S |
| Molecular Weight | 715.97 g/mol |
| Exact Mass | 715.30 |
| IUPAC Name | (E)-3-[5-[3,5-bis(2,4-dimethyl-N-naphthalen-1-ylanilino)phenyl]thiophen-2-yl]-2-methylprop-2-enenitrile |
| SMILES | C/C(C#N)=C\c1ccc(-c2cc(N(c3ccc(C)cc3C)c3cccc4ccccc34)cc(N(c3ccc(C)cc3C)c3cccc4ccccc34)c2)s1 |
| InChI | InChI=1S/C50H41N3S/c1-33-20-23-46(36(4)26-33)52(48-18-10-14-38-12-6-8-16-44(38)48)41-29-40(50-25-22-43(54-50)28-35(3)32-51)30-42(31-41)53(47-24-21-34(2)27-37(47)5)49-19-11-15-39-13-7-9-17-45(39)49/h6-31H,1-5H3/b35-28+ |
| InChIKey | FJOZQVHEPZFYLO-AWQADKOQSA-N |
| XLogP | 14.82 |
| TPSA | 30.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 715.97 |
| LogP ≤ 5 | 14.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|