C26H14N2S3 — CID 177465509
2-[[5-[5-(5-naphthalen-1-ylthiophen-2-yl)thiophen-2-yl]thiophen-2-yl]methylidene]propanedinitrile (PubChem CID 177465509) has the molecular formula C26H14N2S3 and a molecular weight of 450.61 g/mol. Its IUPAC name is 2-[[5-[5-(5-naphthalen-1-ylthiophen-2-yl)thiophen-2-yl]thiophen-2-yl]methylidene]propanedinitrile.
| Compound Name | 2-[[5-[5-(5-naphthalen-1-ylthiophen-2-yl)thiophen-2-yl]thiophen-2-yl]methylidene]propanedinitrile |
|---|---|
| PubChem CID | 177465509 |
| Molecular Formula | C26H14N2S3 |
| Molecular Weight | 450.61 g/mol |
| Exact Mass | 450.03 |
| IUPAC Name | 2-[[5-[5-(5-naphthalen-1-ylthiophen-2-yl)thiophen-2-yl]thiophen-2-yl]methylidene]propanedinitrile |
| SMILES | N#CC(C#N)=Cc1ccc(-c2ccc(-c3ccc(-c4cccc5ccccc45)s3)s2)s1 |
| InChI | InChI=1S/C26H14N2S3/c27-15-17(16-28)14-19-8-9-23(29-19)24-12-13-26(31-24)25-11-10-22(30-25)21-7-3-5-18-4-1-2-6-20(18)21/h1-14H |
| InChIKey | QTYWVPXQWVHVTK-UHFFFAOYSA-N |
| XLogP | 8.46 |
| TPSA | 47.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.61 |
| LogP ≤ 5 | 8.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|