C42H35N3S — CID 138552124
2-[[5-[12-(3,5-ditert-butylphenyl)-12-azapentacyclo[11.7.1.02,11.04,9.017,21]henicosa-1(20),2,4,6,8,10,13(21),14,16,18-decaen-16-yl]thiophen-2-yl]methylidene]propanedinitrile (PubChem CID 138552124) has the molecular formula C42H35N3S and a molecular weight of 613.83 g/mol. Its IUPAC name is 2-[[5-[12-(3,5-ditert-butylphenyl)-12-azapentacyclo[11.7.1.02,11.04,9.017,21]henicosa-1(20),2,4,6,8,10,13(21),14,16,18-decaen-16-yl]thiophen-2-yl]methylidene]propanedinitrile.
| Compound Name | 2-[[5-[12-(3,5-ditert-butylphenyl)-12-azapentacyclo[11.7.1.02,11.04,9.017,21]henicosa-1(20),2,4,6,8,10,13(21),14,16,18-decaen-16-yl]thiophen-2-yl]methylidene]propanedinitrile |
|---|---|
| PubChem CID | 138552124 |
| Molecular Formula | C42H35N3S |
| Molecular Weight | 613.83 g/mol |
| Exact Mass | 613.26 |
| IUPAC Name | 2-[[5-[12-(3,5-ditert-butylphenyl)-12-azapentacyclo[11.7.1.02,11.04,9.017,21]henicosa-1(20),2,4,6,8,10,13(21),14,16,18-decaen-16-yl]thiophen-2-yl]methylidene]propanedinitrile |
| SMILES | CC(C)(C)c1cc(N2c3cc4ccccc4cc3-c3cccc4c(-c5ccc(C=C(C#N)C#N)s5)ccc2c34)cc(C(C)(C)C)c1 |
| InChI | InChI=1S/C42H35N3S/c1-41(2,3)29-21-30(42(4,5)6)23-31(22-29)45-37-16-15-33(39-17-14-32(46-39)18-26(24-43)25-44)34-12-9-13-35(40(34)37)36-19-27-10-7-8-11-28(27)20-38(36)45/h7-23H,1-6H3 |
| InChIKey | FBJVHSCPHNQKSP-UHFFFAOYSA-N |
| XLogP | 12.20 |
| TPSA | 50.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 613.83 |
| LogP ≤ 5 | 12.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|