C13H9N3S2 — CID 170943915
2-[[5-[5-(aminomethyl)thiophen-2-yl]thiophen-2-yl]methylidene]propanedinitrile (PubChem CID 170943915) has the molecular formula C13H9N3S2 and a molecular weight of 271.37 g/mol. Its IUPAC name is 2-[[5-[5-(aminomethyl)thiophen-2-yl]thiophen-2-yl]methylidene]propanedinitrile.
| Compound Name | 2-[[5-[5-(aminomethyl)thiophen-2-yl]thiophen-2-yl]methylidene]propanedinitrile |
|---|---|
| PubChem CID | 170943915 |
| Molecular Formula | C13H9N3S2 |
| Molecular Weight | 271.37 g/mol |
| Exact Mass | 271.02 |
| IUPAC Name | 2-[[5-[5-(aminomethyl)thiophen-2-yl]thiophen-2-yl]methylidene]propanedinitrile |
| SMILES | N#CC(C#N)=Cc1ccc(-c2ccc(CN)s2)s1 |
| InChI | InChI=1S/C13H9N3S2/c14-6-9(7-15)5-10-1-3-12(17-10)13-4-2-11(8-16)18-13/h1-5H,8,16H2 |
| InChIKey | UXJOYLTYRDUGCP-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 73.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.37 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|