C17H11N3S2 — CID 132516004
2-[[5-[5-(1-methylpyrrol-2-yl)thiophen-2-yl]thiophen-2-yl]methylidene]propanedinitrile (PubChem CID 132516004) has the molecular formula C17H11N3S2 and a molecular weight of 321.43 g/mol. Its IUPAC name is 2-[[5-[5-(1-methylpyrrol-2-yl)thiophen-2-yl]thiophen-2-yl]methylidene]propanedinitrile.
| Compound Name | 2-[[5-[5-(1-methylpyrrol-2-yl)thiophen-2-yl]thiophen-2-yl]methylidene]propanedinitrile |
|---|---|
| PubChem CID | 132516004 |
| Molecular Formula | C17H11N3S2 |
| Molecular Weight | 321.43 g/mol |
| Exact Mass | 321.04 |
| IUPAC Name | 2-[[5-[5-(1-methylpyrrol-2-yl)thiophen-2-yl]thiophen-2-yl]methylidene]propanedinitrile |
| SMILES | Cn1cccc1-c1ccc(-c2ccc(C=C(C#N)C#N)s2)s1 |
| InChI | InChI=1S/C17H11N3S2/c1-20-8-2-3-14(20)15-6-7-17(22-15)16-5-4-13(21-16)9-12(10-18)11-19/h2-9H,1H3 |
| InChIKey | GFEGATLCLYBXOS-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 52.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.43 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|