C34H25F2N3S — CID 157428693
2-[[5-[8-(4-tert-butylphenyl)-8-azatetracyclo[7.7.1.02,7.013,17]heptadeca-1(16),2,4,6,9(17),10,12,14-octaen-12-yl]thiophen-2-yl]methylidene]propanedinitrile;molecular fluorine (PubChem CID 157428693) has the molecular formula C34H25F2N3S and a molecular weight of 545.66 g/mol. Its IUPAC name is 2-[[5-[8-(4-tert-butylphenyl)-8-azatetracyclo[7.7.1.02,7.013,17]heptadeca-1(16),2,4,6,9(17),10,12,14-octaen-12-yl]thiophen-2-yl]methylidene]propanedinitrile;molecular fluorine.
| Compound Name | 2-[[5-[8-(4-tert-butylphenyl)-8-azatetracyclo[7.7.1.02,7.013,17]heptadeca-1(16),2,4,6,9(17),10,12,14-octaen-12-yl]thiophen-2-yl]methylidene]propanedinitrile;molecular fluorine |
|---|---|
| PubChem CID | 157428693 |
| Molecular Formula | C34H25F2N3S |
| Molecular Weight | 545.66 g/mol |
| Exact Mass | 545.17 |
| IUPAC Name | 2-[[5-[8-(4-tert-butylphenyl)-8-azatetracyclo[7.7.1.02,7.013,17]heptadeca-1(16),2,4,6,9(17),10,12,14-octaen-12-yl]thiophen-2-yl]methylidene]propanedinitrile;molecular fluorine |
| SMILES | CC(C)(C)c1ccc(N2c3ccccc3-c3cccc4c(-c5ccc(C=C(C#N)C#N)s5)ccc2c34)cc1.FF |
| InChI | InChI=1S/C34H25N3S.F2/c1-34(2,3)23-11-13-24(14-12-23)37-30-10-5-4-7-26(30)28-8-6-9-29-27(16-17-31(37)33(28)29)32-18-15-25(38-32)19-22(20-35)21-36;1-2/h4-19H,1-3H3; |
| InChIKey | BQGRHAAZQQEDJR-UHFFFAOYSA-N |
| XLogP | 10.59 |
| TPSA | 50.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.66 |
| LogP ≤ 5 | 10.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|