C40H23NO2S — CID 101466533
(E)-2-cyano-3-[5-(7,12-diphenylbenzo[k]fluoranthen-3-yl)thiophen-2-yl]prop-2-enoic acid (PubChem CID 101466533) has the molecular formula C40H23NO2S and a molecular weight of 581.70 g/mol. Its IUPAC name is (E)-2-cyano-3-[5-(7,12-diphenylbenzo[k]fluoranthen-3-yl)thiophen-2-yl]prop-2-enoic acid.
| Compound Name | (E)-2-cyano-3-[5-(7,12-diphenylbenzo[k]fluoranthen-3-yl)thiophen-2-yl]prop-2-enoic acid |
|---|---|
| PubChem CID | 101466533 |
| Molecular Formula | C40H23NO2S |
| Molecular Weight | 581.70 g/mol |
| Exact Mass | 581.14 |
| IUPAC Name | (E)-2-cyano-3-[5-(7,12-diphenylbenzo[k]fluoranthen-3-yl)thiophen-2-yl]prop-2-enoic acid |
| SMILES | N#C/C(=C\c1ccc(-c2ccc3c4c(cccc24)-c2c-3c(-c3ccccc3)c3ccccc3c2-c2ccccc2)s1)C(=O)O |
| InChI | InChI=1S/C40H23NO2S/c41-23-26(40(42)43)22-27-18-21-34(44-27)28-19-20-33-37-29(28)16-9-17-32(37)38-35(24-10-3-1-4-11-24)30-14-7-8-15-31(30)36(39(33)38)25-12-5-2-6-13-25/h1-22H,(H,42,43)/b26-22+ |
| InChIKey | JXIXENVJBAMVLV-XTCLZLMSSA-N |
| XLogP | 10.69 |
| TPSA | 61.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 581.70 |
| LogP ≤ 5 | 10.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|