C26H21N2O4S2+ — CID 87516236
[4-[5-[5-[(E)-2-carboxy-2-cyanoethenyl]thiophen-2-yl]thiophen-2-yl]phenyl]-dimethoxy-phenylazanium (PubChem CID 87516236) has the molecular formula C26H21N2O4S2+ and a molecular weight of 489.60 g/mol. Its IUPAC name is [4-[5-[5-[(E)-2-carboxy-2-cyanoethenyl]thiophen-2-yl]thiophen-2-yl]phenyl]-dimethoxy-phenylazanium.
| Compound Name | [4-[5-[5-[(E)-2-carboxy-2-cyanoethenyl]thiophen-2-yl]thiophen-2-yl]phenyl]-dimethoxy-phenylazanium |
|---|---|
| PubChem CID | 87516236 |
| Molecular Formula | C26H21N2O4S2+ |
| Molecular Weight | 489.60 g/mol |
| Exact Mass | 489.09 |
| IUPAC Name | [4-[5-[5-[(E)-2-carboxy-2-cyanoethenyl]thiophen-2-yl]thiophen-2-yl]phenyl]-dimethoxy-phenylazanium |
| SMILES | CO[N+](OC)(c1ccccc1)c1ccc(-c2ccc(-c3ccc(/C=C(\C#N)C(=O)O)s3)s2)cc1 |
| InChI | InChI=1S/C26H20N2O4S2/c1-31-28(32-2,20-6-4-3-5-7-20)21-10-8-18(9-11-21)23-14-15-25(34-23)24-13-12-22(33-24)16-19(17-27)26(29)30/h3-16H,1-2H3/p+1/b19-16+ |
| InChIKey | ADASOKVYJSMNGZ-KNTRCKAVSA-O |
| XLogP | 6.90 |
| TPSA | 79.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.60 |
| LogP ≤ 5 | 6.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|