C23H16N2O2S — CID 177492700
(Z)-2-cyano-3-[5-(1-methyl-2-phenylindolizin-3-yl)thiophen-2-yl]prop-2-enoic acid (PubChem CID 177492700) has the molecular formula C23H16N2O2S and a molecular weight of 384.46 g/mol. Its IUPAC name is (Z)-2-cyano-3-[5-(1-methyl-2-phenylindolizin-3-yl)thiophen-2-yl]prop-2-enoic acid.
| Compound Name | (Z)-2-cyano-3-[5-(1-methyl-2-phenylindolizin-3-yl)thiophen-2-yl]prop-2-enoic acid |
|---|---|
| PubChem CID | 177492700 |
| Molecular Formula | C23H16N2O2S |
| Molecular Weight | 384.46 g/mol |
| Exact Mass | 384.09 |
| IUPAC Name | (Z)-2-cyano-3-[5-(1-methyl-2-phenylindolizin-3-yl)thiophen-2-yl]prop-2-enoic acid |
| SMILES | Cc1c(-c2ccccc2)c(-c2ccc(/C=C(/C#N)C(=O)O)s2)n2ccccc12 |
| InChI | InChI=1S/C23H16N2O2S/c1-15-19-9-5-6-12-25(19)22(21(15)16-7-3-2-4-8-16)20-11-10-18(28-20)13-17(14-24)23(26)27/h2-13H,1H3,(H,26,27)/b17-13- |
| InChIKey | LDCCADZOYBWCSA-LGMDPLHJSA-N |
| XLogP | 5.63 |
| TPSA | 65.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.46 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|