C54H47N3OS — CID 143793396
(Z)-3-[5-[3,5-bis(4-methyl-N-naphthalen-1-ylanilino)phenyl]-3-hexylthiophen-2-yl]-2-formylprop-2-enenitrile (PubChem CID 143793396) has the molecular formula C54H47N3OS and a molecular weight of 786.06 g/mol. Its IUPAC name is (Z)-3-[5-[3,5-bis(4-methyl-N-naphthalen-1-ylanilino)phenyl]-3-hexylthiophen-2-yl]-2-formylprop-2-enenitrile.
| Compound Name | (Z)-3-[5-[3,5-bis(4-methyl-N-naphthalen-1-ylanilino)phenyl]-3-hexylthiophen-2-yl]-2-formylprop-2-enenitrile |
|---|---|
| PubChem CID | 143793396 |
| Molecular Formula | C54H47N3OS |
| Molecular Weight | 786.06 g/mol |
| Exact Mass | 785.34 |
| IUPAC Name | (Z)-3-[5-[3,5-bis(4-methyl-N-naphthalen-1-ylanilino)phenyl]-3-hexylthiophen-2-yl]-2-formylprop-2-enenitrile |
| SMILES | CCCCCCc1cc(-c2cc(N(c3ccc(C)cc3)c3cccc4ccccc34)cc(N(c3ccc(C)cc3)c3cccc4ccccc34)c2)sc1/C=C(/C#N)C=O |
| InChI | InChI=1S/C54H47N3OS/c1-4-5-6-7-16-43-34-54(59-53(43)31-40(36-55)37-58)44-32-47(56(45-27-23-38(2)24-28-45)51-21-12-17-41-14-8-10-19-49(41)51)35-48(33-44)57(46-29-25-39(3)26-30-46)52-22-13-18-42-15-9-11-20-50(42)52/h8-15,17-35,37H,4-7,16H2,1-3H3/b40-31- |
| InChIKey | LEFBWSVHGSVPNH-JLQWMSMUSA-N |
| XLogP | 15.51 |
| TPSA | 47.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 59 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 786.06 |
| LogP ≤ 5 | 15.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|